cas: 346593-03-1 — see every product listed under this CAS number, including other names
tert-Butyl 2,2-dimethyl-4-oxopiperidine-1-carboxylate, 98%, 98% (CAS 346593-03-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1143OM-100mg |
| cas | 346593-03-1 |
| size | 100mg |
| availability | 200g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 500mg | 112.40 Pln | |
| Chemat | 1g | 136.40 Pln | |
| Chemat | 5g | 309.20 Pln | |
| Chemat | 10g | 448.40 Pln | |
| Chemat | 25g | 957.20 Pln | |
| Chemat | 50g | 1782.80 Pln | |
| Chemat | 100g | 3371.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 2,2-dimethyl-4-oxopiperidine-1-carboxylate (CAS 346593-03-1) is a chemical compound with the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. IUPAC name: tert-butyl 2,2-dimethyl-4-oxopiperidine-1-carboxylate. InChIKey: DFWLCLMWDGTEHR-UHFFFAOYSA-N.
| Molecular formula | C12H21NO3 |
|---|---|
| Molecular weight | 227.30 g/mol |
| IUPAC name | tert-butyl 2,2-dimethyl-4-oxopiperidine-1-carboxylate |
| InChIKey | DFWLCLMWDGTEHR-UHFFFAOYSA-N |
| SMILES | CC1(CC(=O)CCN1C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)