CAS 197792-52-2 appears in our catalog under these names: tert–Butyl 2–(3–bromophenyl)acetate, tert-Butyl 2-(3-bromophenyl)acetate, 97%, tert-Butyl (3-bromophenyl)acetate, 95%, 95%. Offered by: GLPBio, Fluorochem, Chemat. Available pack sizes: 1g, 5g, 25g, 100mg, 250mg.
Tert-butyl 2-(3-bromophenyl)acetate (CAS 197792-52-2) is a chemical compound with the molecular formula C12H15BrO2 and a molecular weight of 271.15 g/mol. IUPAC name: tert-butyl 2-(3-bromophenyl)acetate. InChIKey: IUQYZZLJRJUKIH-UHFFFAOYSA-N.
| Molecular formula | C12H15BrO2 |
|---|---|
| Molecular weight | 271.15 g/mol |
| IUPAC name | tert-butyl 2-(3-bromophenyl)acetate |
| InChIKey | IUQYZZLJRJUKIH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CC1=CC(=CC=C1)Br |
Computed by PubChem (NCBI)