tert-Butyl 2-(3-oxopiperazin-1-yl)acetate, 95%
cas: 1056057-55-6 — see every product listed under this CAS number, including other names
tert-Butyl 2-(3-oxopiperazin-1-yl)acetate, 95% (CAS 1056057-55-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1038136-250mg |
| cas | 1056057-55-6 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 220.19 Pln | |
| Ambeed | 1g | 492.75 Pln | |
| Ambeed | 5g | 1816.62 Pln | |
| BLDpharm | 100mg | 136.64 Pln | |
| BLDpharm | 250mg | 231.05 Pln | |
| BLDpharm | 1g | 525.40 Pln | |
| BLDpharm | 5g | 1952.67 Pln | |
| Chemat | 100mg | 131.60 Pln | |
| Chemat | 250mg | 174.80 Pln | |
| Chemat | 1g | 400.40 Pln | |
| Chemat | 5g | 1432.40 Pln | |
| Fluorochem | 100mg | 211.40 Pln | |
| Fluorochem | 250mg | 299.91 Pln | |
| Fluorochem | 1g | 726.85 Pln | |
| Fluorochem | 5g | 2663.66 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
Tert-butyl 2-(3-oxopiperazin-1-yl)acetate (CAS 1056057-55-6) is a chemical compound with the molecular formula C10H18N2O3 and a molecular weight of 214.26 g/mol. IUPAC name: tert-butyl 2-(3-oxopiperazin-1-yl)acetate. InChIKey: UCIUMZXITSLNPQ-UHFFFAOYSA-N.
| Molecular formula | C10H18N2O3 |
|---|---|
| Molecular weight | 214.26 g/mol |
| IUPAC name | tert-butyl 2-(3-oxopiperazin-1-yl)acetate |
| InChIKey | UCIUMZXITSLNPQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CN1CCNC(=O)C1 |
Computed by PubChem (NCBI)