cas: 1072944-96-7 — see every product listed under this CAS number, including other names
tert-Butyl 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-1-carboxylate, 95% (CAS 1072944-96-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 250mg. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | F213554-1G |
| cas | 1072944-96-7 |
| size | 1g |
| availability | In Stock Germany |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 247.85 Pln | |
| Fluorochem | 5g | 851.80 Pln | |
| Fluorochem | 10g | 1622.36 Pln | |
| Fluorochem | 25g | 3866.36 Pln | |
| Ambeed | 250mg | 153.44 Pln | |
| Ambeed | 1g | 242.44 Pln | |
| Ambeed | 5g | 909.94 Pln | |
| Ambeed | 10g | 1744.31 Pln | |
| Ambeed | 25g | 4080.56 Pln |
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
Tert-butyl 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate (CAS 1072944-96-7) is a chemical compound with the molecular formula C19H26BNO4 and a molecular weight of 343.2 g/mol. IUPAC name: tert-butyl 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate. InChIKey: XHSKHKAKSUSKKP-UHFFFAOYSA-N.
| Molecular formula | C19H26BNO4 |
|---|---|
| Molecular weight | 343.2 g/mol |
| IUPAC name | tert-butyl 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate |
| InChIKey | XHSKHKAKSUSKKP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=CC=CC=C3N2C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)