cas: 1607800-84-9 — see every product listed under this CAS number, including other names
tert-Butyl 2-(4-bromophenyl)-1H-pyrrole-1-carboxylate 97% (CAS 1607800-84-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A765995-100mg |
| cas | 1607800-84-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 303.62 Pln | |
| Ambeed | 250mg | 492.75 Pln | |
| Ambeed | 1g | 1199.19 Pln | |
| Ambeed | 5g | 3958.19 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A765995 |
Tert-butyl 2-(4-bromophenyl)pyrrole-1-carboxylate (CAS 1607800-84-9) is a chemical compound with the molecular formula C15H16BrNO2 and a molecular weight of 322.20 g/mol. IUPAC name: tert-butyl 2-(4-bromophenyl)pyrrole-1-carboxylate. InChIKey: JEPLBCFIBMLQAJ-UHFFFAOYSA-N.
| Molecular formula | C15H16BrNO2 |
|---|---|
| Molecular weight | 322.20 g/mol |
| IUPAC name | tert-butyl 2-(4-bromophenyl)pyrrole-1-carboxylate |
| InChIKey | JEPLBCFIBMLQAJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=CC=C1C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)