cas: 1266119-33-8 — see every product listed under this CAS number, including other names
tert-Butyl 2-(4-bromopyridin-2-yl)acetate, 96%, 96% (CAS 1266119-33-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 100mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FOVE-250mg |
| cas | 1266119-33-8 |
| size | 250mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 203.60 Pln | |
| Chemat | 100mg | 117.20 Pln | |
| Chemat | 1g | 621.20 Pln | |
| Chemat | 5g | 2498.00 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 2-(4-bromo-2-pyridinyl)acetate (CAS 1266119-33-8) is a chemical compound with the molecular formula C11H14BrNO2 and a molecular weight of 272.14 g/mol. IUPAC name: tert-butyl 2-(4-bromo-2-pyridinyl)acetate. InChIKey: YRGXZFJOWJAGQO-UHFFFAOYSA-N.
| Molecular formula | C11H14BrNO2 |
|---|---|
| Molecular weight | 272.14 g/mol |
| IUPAC name | tert-butyl 2-(4-bromo-2-pyridinyl)acetate |
| InChIKey | YRGXZFJOWJAGQO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CC1=NC=CC(=C1)Br |
Computed by PubChem (NCBI)