CAS 1356037-30-3 appears in our catalog under these names: tert-Butyl 5-bromo-3-methylpicolinate, 98%, tert-Butyl 5-bromo-3-methylpicolinate 98%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g, 25g, 100g.
Tert-butyl 5-bromo-3-methylpyridine-2-carboxylate (CAS 1356037-30-3) is a chemical compound with the molecular formula C11H14BrNO2 and a molecular weight of 272.14 g/mol. IUPAC name: tert-butyl 5-bromo-3-methylpyridine-2-carboxylate. InChIKey: VYEFIDLPUQXRNR-UHFFFAOYSA-N.
| Molecular formula | C11H14BrNO2 |
|---|---|
| Molecular weight | 272.14 g/mol |
| IUPAC name | tert-butyl 5-bromo-3-methylpyridine-2-carboxylate |
| InChIKey | VYEFIDLPUQXRNR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CN=C1C(=O)OC(C)(C)C)Br |
Computed by PubChem (NCBI)