cas: 105340-30-5 — see every product listed under this CAS number, including other names
tert-Butyl 2-(bromomethyl)benzoate, 97% (CAS 105340-30-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A323186-1g |
| cas | 105340-30-5 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 10056.34 Pln | |
| AmBeed | 5g | 30113.65 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
Tert-butyl 2-(bromomethyl)benzoate (CAS 105340-30-5) is a chemical compound with the molecular formula C12H15BrO2 and a molecular weight of 271.15 g/mol. IUPAC name: tert-butyl 2-(bromomethyl)benzoate. InChIKey: CZZWLGQCYJDGCR-UHFFFAOYSA-N.
| Molecular formula | C12H15BrO2 |
|---|---|
| Molecular weight | 271.15 g/mol |
| IUPAC name | tert-butyl 2-(bromomethyl)benzoate |
| InChIKey | CZZWLGQCYJDGCR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC=CC=C1CBr |
Computed by PubChem (NCBI)