cas: 2246556-84-1 — see every product listed under this CAS number, including other names
tert-Butyl 2-(tetramethyl-1,3,2-dioxaborolan-2-yl)-4H,6H,7H-thieno[3,2-c]pyridine-5-carboxylate, 98%, 98% (CAS 2246556-84-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11JMYN-100mg |
| cas | 2246556-84-1 |
| size | 100mg |
| availability | 125g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 189.20 Pln | |
| Chemat | 250mg | 294.80 Pln | |
| Chemat | 1g | 669.20 Pln | |
| Chemat | 5g | 2056.40 Pln | |
| Chemat | 10g | 3458.00 Pln | |
| Chemat | 25g | 6851.60 Pln | |
| Chemat | 50mg | 136.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboxylate (CAS 2246556-84-1) is a chemical compound with the molecular formula C18H28BNO4S and a molecular weight of 365.3 g/mol. IUPAC name: tert-butyl 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboxylate. InChIKey: PNURUDISZTVTLZ-UHFFFAOYSA-N.
| Molecular formula | C18H28BNO4S |
|---|---|
| Molecular weight | 365.3 g/mol |
| IUPAC name | tert-butyl 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboxylate |
| InChIKey | PNURUDISZTVTLZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(S2)CCN(C3)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)