cas: 150986-83-7 — see every product listed under this CAS number, including other names
tert-Butyl 2-amino-3-cyano-4,5-dihydrothieno[2,3-c]pyridine-6(7H)-carboxylate, 95%, 95% (CAS 150986-83-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g, 5g, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112MZ2-250mg |
| cas | 150986-83-7 |
| size | 250mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 270.80 Pln | |
| Chemat | 500mg | 371.60 Pln | |
| Chemat | 1g | 640.40 Pln | |
| Chemat | 5g | 1821.20 Pln | |
| Chemat | 100mg | 179.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 2-amino-3-cyano-5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate (CAS 150986-83-7) is a chemical compound with the molecular formula C13H17N3O2S and a molecular weight of 279.36 g/mol. IUPAC name: tert-butyl 2-amino-3-cyano-5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate. InChIKey: HFWVFBQVIXKINU-UHFFFAOYSA-N.
| Molecular formula | C13H17N3O2S |
|---|---|
| Molecular weight | 279.36 g/mol |
| IUPAC name | tert-butyl 2-amino-3-cyano-5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate |
| InChIKey | HFWVFBQVIXKINU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C(C1)SC(=C2C#N)N |
Computed by PubChem (NCBI)