cas: 150986-83-7 — see every product listed under this CAS number, including other names
tert-Butyl 2-amino-3-cyano-4,7-dihydrothieno[2,3-c]pyridine-6(5H)-carboxylate 95% (CAS 150986-83-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A529854-100mg |
| cas | 150986-83-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 220.19 Pln | |
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 826.50 Pln | |
| Ambeed | 5g | 2361.75 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A529854 |
Tert-butyl 2-amino-3-cyano-5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate (CAS 150986-83-7) is a chemical compound with the molecular formula C13H17N3O2S and a molecular weight of 279.36 g/mol. IUPAC name: tert-butyl 2-amino-3-cyano-5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate. InChIKey: HFWVFBQVIXKINU-UHFFFAOYSA-N.
| Molecular formula | C13H17N3O2S |
|---|---|
| Molecular weight | 279.36 g/mol |
| IUPAC name | tert-butyl 2-amino-3-cyano-5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate |
| InChIKey | HFWVFBQVIXKINU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C(C1)SC(=C2C#N)N |
Computed by PubChem (NCBI)