cas: 1034975-35-3 — see every product listed under this CAS number, including other names
tert-Butyl 2-amino-4-(4-methylpiperazin-1-yl)benzoate, 97% (CAS 1034975-35-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F614463-100MG |
| cas | 1034975-35-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 91.65 Pln | |
| Fluorochem | 250mg | 91.65 Pln | |
| Fluorochem | 5g | 294.71 Pln | |
| Fluorochem | 25g | 1039.24 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 2-amino-4-(4-methylpiperazin-1-yl)benzoate (CAS 1034975-35-3) is a chemical compound with the molecular formula C16H25N3O2 and a molecular weight of 291.39 g/mol. IUPAC name: tert-butyl 2-amino-4-(4-methylpiperazin-1-yl)benzoate. InChIKey: DIFVPEGUJIXKOC-UHFFFAOYSA-N.
| Molecular formula | C16H25N3O2 |
|---|---|
| Molecular weight | 291.39 g/mol |
| IUPAC name | tert-butyl 2-amino-4-(4-methylpiperazin-1-yl)benzoate |
| InChIKey | DIFVPEGUJIXKOC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=C(C=C(C=C1)N2CCN(CC2)C)N |
Computed by PubChem (NCBI)