cas: 1313712-23-0 — see every product listed under this CAS number, including other names
tert-Butyl 2-amino-6,7-dihydrothiazolo[5,4-b]pyridine-4(5H)-carboxylate 95% (CAS 1313712-23-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A311300-100mg |
| cas | 1313712-23-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 309.19 Pln | |
| Ambeed | 250mg | 476.06 Pln | |
| Ambeed | 1g | 1115.75 Pln | |
| Ambeed | 5g | 3769.06 Pln | |
| Ambeed | 25g | 12646.81 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A311300 |
Tert-butyl 2-amino-6,7-dihydro-5H-[1,3]thiazolo[5,4-b]pyridine-4-carboxylate (CAS 1313712-23-0) is a chemical compound with the molecular formula C11H17N3O2S and a molecular weight of 255.34 g/mol. IUPAC name: tert-butyl 2-amino-6,7-dihydro-5H-[1,3]thiazolo[5,4-b]pyridine-4-carboxylate. InChIKey: LZNIMGWYMCZLLL-UHFFFAOYSA-N.
| Molecular formula | C11H17N3O2S |
|---|---|
| Molecular weight | 255.34 g/mol |
| IUPAC name | tert-butyl 2-amino-6,7-dihydro-5H-[1,3]thiazolo[5,4-b]pyridine-4-carboxylate |
| InChIKey | LZNIMGWYMCZLLL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC2=C1SC(=N2)N |
Computed by PubChem (NCBI)