cas: 1149333-40-3 — see every product listed under this CAS number, including other names
tert-Butyl 2-amino-7,8-dihydro-1,6-naphthyridine-6(5H)-carboxylate 95% (CAS 1149333-40-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A737195-100mg |
| cas | 1149333-40-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 387.06 Pln | |
| Ambeed | 250mg | 542.81 Pln | |
| Ambeed | 1g | 1282.62 Pln | |
| Ambeed | 5g | 4775.88 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A737195 |
Tert-butyl 2-amino-7,8-dihydro-5H-1,6-naphthyridine-6-carboxylate (CAS 1149333-40-3) is a chemical compound with the molecular formula C13H19N3O2 and a molecular weight of 249.31 g/mol. IUPAC name: tert-butyl 2-amino-7,8-dihydro-5H-1,6-naphthyridine-6-carboxylate. InChIKey: LVCYIRQQPQEBSD-UHFFFAOYSA-N.
| Molecular formula | C13H19N3O2 |
|---|---|
| Molecular weight | 249.31 g/mol |
| IUPAC name | tert-butyl 2-amino-7,8-dihydro-5H-1,6-naphthyridine-6-carboxylate |
| InChIKey | LVCYIRQQPQEBSD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C(C1)C=CC(=N2)N |
Computed by PubChem (NCBI)