cas: 75898-42-9 — see every product listed under this CAS number, including other names
tert-Butyl 2-bromo-3-phenylpropanoate, 95% (CAS 75898-42-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F719782-100MG |
| cas | 75898-42-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 633.13 Pln | |
| Fluorochem | 250mg | 846.59 Pln | |
| Fluorochem | 1g | 1903.51 Pln | |
| Fluorochem | 5g | 5485.59 Pln | |
| Fluorochem | 10g | 9296.74 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 2-bromo-3-phenylpropanoate (CAS 75898-42-9) is a chemical compound with the molecular formula C13H17BrO2 and a molecular weight of 285.18 g/mol. IUPAC name: tert-butyl 2-bromo-3-phenylpropanoate. InChIKey: GDAQVQPJSOCIJI-UHFFFAOYSA-N.
| Molecular formula | C13H17BrO2 |
|---|---|
| Molecular weight | 285.18 g/mol |
| IUPAC name | tert-butyl 2-bromo-3-phenylpropanoate |
| InChIKey | GDAQVQPJSOCIJI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C(CC1=CC=CC=C1)Br |
Computed by PubChem (NCBI)