cas: 1374651-93-0 — see every product listed under this CAS number, including other names
tert-Butyl 2-bromo-5-fluoropyridin-4-ylcarbamate, 95% (CAS 1374651-93-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 50mg, 250mg, 5g, 10g. Offered by: Combi-blocks, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | QK-5563-100mg |
| cas | 1374651-93-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 100mg | price on request | |
| Combi-blocks | 1g | price on request | |
| Fluorochem | 50mg | 362.39 Pln | |
| Fluorochem | 100mg | 529.00 Pln | |
| Fluorochem | 250mg | 877.83 Pln | |
| Fluorochem | 1g | 2382.51 Pln | |
| Fluorochem | 5g | 7906.61 Pln | |
| Fluorochem | 10g | 12920.47 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
Tert-butyl N-(2-bromo-5-fluoro-4-pyridinyl)carbamate (CAS 1374651-93-0) is a chemical compound with the molecular formula C10H12BrFN2O2 and a molecular weight of 291.12 g/mol. IUPAC name: tert-butyl N-(2-bromo-5-fluoro-4-pyridinyl)carbamate. InChIKey: UPAOPDGTOQVOEK-UHFFFAOYSA-N.
| Molecular formula | C10H12BrFN2O2 |
|---|---|
| Molecular weight | 291.12 g/mol |
| IUPAC name | tert-butyl N-(2-bromo-5-fluoro-4-pyridinyl)carbamate |
| InChIKey | UPAOPDGTOQVOEK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC(=NC=C1F)Br |
Computed by PubChem (NCBI)