cas: 1253654-37-3 — see every product listed under this CAS number, including other names
tert-Butyl 2-bromo-6,7-dihydrothiazolo[4,5-c]pyridine-5(4H)-carboxylate, 98%, 98% (CAS 1253654-37-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111NJF-100mg |
| cas | 1253654-37-3 |
| size | 100mg |
| availability | 8g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 318.80 Pln | |
| Chemat | 250mg | 501.20 Pln | |
| Chemat | 1g | 1384.40 Pln | |
| Chemat | 5g | 4106.00 Pln | |
| Chemat | 500mg | 890.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 2-bromo-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridine-5-carboxylate (CAS 1253654-37-3) is a chemical compound with the molecular formula C11H15BrN2O2S and a molecular weight of 319.22 g/mol. IUPAC name: tert-butyl 2-bromo-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridine-5-carboxylate. InChIKey: KIUXKAOCQBIEAI-UHFFFAOYSA-N.
| Molecular formula | C11H15BrN2O2S |
|---|---|
| Molecular weight | 319.22 g/mol |
| IUPAC name | tert-butyl 2-bromo-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridine-5-carboxylate |
| InChIKey | KIUXKAOCQBIEAI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C(C1)N=C(S2)Br |
Computed by PubChem (NCBI)