tert-Butyl 2-bromo-6-methylbenzoate, 95%
cas: 1628351-93-8 — see every product listed under this CAS number, including other names
tert-Butyl 2-bromo-6-methylbenzoate, 95% (CAS 1628351-93-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A2257445-250mg |
| cas | 1628351-93-8 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 186.81 Pln | |
| Ambeed | 1g | 342.56 Pln | |
| Ambeed | 5g | 1021.19 Pln | |
| Ambeed | 10g | 1594.12 Pln | |
| Chemat | 250mg | 126.80 Pln | |
| Chemat | 1g | 184.40 Pln | |
| Chemat | 5g | 477.20 Pln | |
| Chemat | 10g | 726.80 Pln | |
| BLDpharm | 250mg | 169.96 Pln | |
| BLDpharm | 1g | 342.13 Pln | |
| BLDpharm | 5g | 1003.00 Pln | |
| BLDpharm | 10g | 1569.47 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
Tert-butyl 2-bromo-6-methylbenzoate (CAS 1628351-93-8) is a chemical compound with the molecular formula C12H15BrO2 and a molecular weight of 271.15 g/mol. IUPAC name: tert-butyl 2-bromo-6-methylbenzoate. InChIKey: RHQAGZDUEIBZBT-UHFFFAOYSA-N.
| Molecular formula | C12H15BrO2 |
|---|---|
| Molecular weight | 271.15 g/mol |
| IUPAC name | tert-butyl 2-bromo-6-methylbenzoate |
| InChIKey | RHQAGZDUEIBZBT-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)Br)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)