cas: 1421311-91-2 — see every product listed under this CAS number, including other names
tert-Butyl 2-chloro-7,8-dihydropyrido[3,2-d]pyrimidine-5(6H)-carboxylate 98% (CAS 1421311-91-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A645952-100mg |
| cas | 1421311-91-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 1382.75 Pln | |
| Ambeed | 250mg | 2578.69 Pln | |
| Ambeed | 1g | 6366.75 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A645952 |
Tert-butyl 2-chloro-7,8-dihydro-6H-pyrido[3,2-d]pyrimidine-5-carboxylate (CAS 1421311-91-2) is a chemical compound with the molecular formula C12H16ClN3O2 and a molecular weight of 269.73 g/mol. IUPAC name: tert-butyl 2-chloro-7,8-dihydro-6H-pyrido[3,2-d]pyrimidine-5-carboxylate. InChIKey: NIVWSHYBKCXEMR-UHFFFAOYSA-N.
| Molecular formula | C12H16ClN3O2 |
|---|---|
| Molecular weight | 269.73 g/mol |
| IUPAC name | tert-butyl 2-chloro-7,8-dihydro-6H-pyrido[3,2-d]pyrimidine-5-carboxylate |
| InChIKey | NIVWSHYBKCXEMR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC2=NC(=NC=C21)Cl |
Computed by PubChem (NCBI)