tert-Butyl 2-formylazepane-1-carboxylate, 95+%
cas: 146337-41-9 — see every product listed under this CAS number, including other names
tert-Butyl 2-formylazepane-1-carboxylate, 95+% (CAS 146337-41-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25mg, 50mg, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A557852-250mg |
| cas | 146337-41-9 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 2161.50 Pln | |
| Ambeed | 1g | 5710.38 Pln | |
| Ambeed | 5g | 22642.62 Pln | |
| Chemat | 25mg | 520.40 Pln | |
| Chemat | 50mg | 837.20 Pln | |
| Chemat | 100mg | 1379.60 Pln | |
| Chemat | 250mg | 2306.00 Pln | |
| Chemat | 1g | 6112.40 Pln | |
| Chemat | 5g | 24256.40 Pln | |
| BLDpharm | 25mg | 530.95 Pln | |
| BLDpharm | 50mg | 858.61 Pln | |
| BLDpharm | 100mg | 1397.31 Pln | |
| BLDpharm | 250mg | 2324.76 Pln | |
| BLDpharm | 1g | 6151.19 Pln | |
| BLDpharm | 5g | 24411.43 Pln |
properties
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
Tert-butyl 2-formylazepane-1-carboxylate (CAS 146337-41-9) is a chemical compound with the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. IUPAC name: tert-butyl 2-formylazepane-1-carboxylate. InChIKey: YYVXGCZFWGOISI-UHFFFAOYSA-N.
| Molecular formula | C12H21NO3 |
|---|---|
| Molecular weight | 227.30 g/mol |
| IUPAC name | tert-butyl 2-formylazepane-1-carboxylate |
| InChIKey | YYVXGCZFWGOISI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCCCC1C=O |
Computed by PubChem (NCBI)