cas: 1260852-42-3 — see every product listed under this CAS number, including other names
tert-Butyl 3,3-difluoro-4-(hydroxymethyl)pyrrolidine-1-carboxylate, 97% (CAS 1260852-42-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg, 500mg. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A481706-1g |
| cas | 1260852-42-3 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 5909.47 Pln | |
| Fluorochem | 250mg | 3736.20 Pln | |
| Fluorochem | 500mg | 6188.46 Pln | |
| Fluorochem | 1g | 9229.06 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
Tert-butyl 3,3-difluoro-4-(hydroxymethyl)pyrrolidine-1-carboxylate (CAS 1260852-42-3) is a chemical compound with the molecular formula C10H17F2NO3 and a molecular weight of 237.24 g/mol. IUPAC name: tert-butyl 3,3-difluoro-4-(hydroxymethyl)pyrrolidine-1-carboxylate. InChIKey: OEMRLSZFXVVDLS-UHFFFAOYSA-N.
| Molecular formula | C10H17F2NO3 |
|---|---|
| Molecular weight | 237.24 g/mol |
| IUPAC name | tert-butyl 3,3-difluoro-4-(hydroxymethyl)pyrrolidine-1-carboxylate |
| InChIKey | OEMRLSZFXVVDLS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C(C1)(F)F)CO |
Computed by PubChem (NCBI)