cas: 1260852-42-3 — see every product listed under this CAS number, including other names
tert-butyl 3,3-difluoro-4-(hydroxymethyl)pyrrolidine-1-carboxylate, 95%, 95% (CAS 1260852-42-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111RGA-100mg |
| cas | 1260852-42-3 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 942.80 Pln | |
| Chemat | 250mg | 1470.80 Pln | |
| Chemat | 1g | 3578.00 Pln | |
| Chemat | 5g | 16643.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 3,3-difluoro-4-(hydroxymethyl)pyrrolidine-1-carboxylate (CAS 1260852-42-3) is a chemical compound with the molecular formula C10H17F2NO3 and a molecular weight of 237.24 g/mol. IUPAC name: tert-butyl 3,3-difluoro-4-(hydroxymethyl)pyrrolidine-1-carboxylate. InChIKey: OEMRLSZFXVVDLS-UHFFFAOYSA-N.
| Molecular formula | C10H17F2NO3 |
|---|---|
| Molecular weight | 237.24 g/mol |
| IUPAC name | tert-butyl 3,3-difluoro-4-(hydroxymethyl)pyrrolidine-1-carboxylate |
| InChIKey | OEMRLSZFXVVDLS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C(C1)(F)F)CO |
Computed by PubChem (NCBI)