cas: 1209780-71-1 — see every product listed under this CAS number, including other names
tert-Butyl 3,3-difluoro-4-hydroxypiperidine-1-carboxylate, 97%, 97% (CAS 1209780-71-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 250g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119Z3R-100mg |
| cas | 1209780-71-1 |
| size | 100mg |
| availability | 250g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 1g | 141.20 Pln | |
| Chemat | 5g | 448.40 Pln | |
| Chemat | 10g | 813.20 Pln | |
| Chemat | 25g | 1562.00 Pln | |
| Chemat | 250g | 9650.00 Pln | |
| Chemat | 50g | 2637.20 Pln | |
| Chemat | 100g | 4850.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 3,3-difluoro-4-hydroxypiperidine-1-carboxylate (CAS 1209780-71-1) is a chemical compound with the molecular formula C10H17F2NO3 and a molecular weight of 237.24 g/mol. IUPAC name: tert-butyl 3,3-difluoro-4-hydroxypiperidine-1-carboxylate. InChIKey: GISYXRBCSOIMTM-UHFFFAOYSA-N.
| Molecular formula | C10H17F2NO3 |
|---|---|
| Molecular weight | 237.24 g/mol |
| IUPAC name | tert-butyl 3,3-difluoro-4-hydroxypiperidine-1-carboxylate |
| InChIKey | GISYXRBCSOIMTM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(C1)(F)F)O |
Computed by PubChem (NCBI)