cas: 887590-25-2 — see every product listed under this CAS number, including other names
tert-Butyl 3,4-dihydroquinoxaline-1(2H)-carboxylate 98% (CAS 887590-25-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A633317-250mg |
| cas | 887590-25-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 364.81 Pln | |
| Ambeed | 1g | 670.75 Pln | |
| Ambeed | 5g | 2489.69 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A633317 |
Tert-butyl 3,4-dihydro-2H-quinoxaline-1-carboxylate (CAS 887590-25-2) is a chemical compound with the molecular formula C13H18N2O2 and a molecular weight of 234.29 g/mol. IUPAC name: tert-butyl 3,4-dihydro-2H-quinoxaline-1-carboxylate. InChIKey: DXXFPGTUHSMYSG-UHFFFAOYSA-N.
| Molecular formula | C13H18N2O2 |
|---|---|
| Molecular weight | 234.29 g/mol |
| IUPAC name | tert-butyl 3,4-dihydro-2H-quinoxaline-1-carboxylate |
| InChIKey | DXXFPGTUHSMYSG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCNC2=CC=CC=C21 |
Computed by PubChem (NCBI)