tert-Butyl 3,5-dimethylpiperazine-1-carboxylate, 97%
cas: 639068-43-2 — see every product listed under this CAS number, including other names
tert-Butyl 3,5-dimethylpiperazine-1-carboxylate, 97% (CAS 639068-43-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 200mg, 10g, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A132840-250mg |
| cas | 639068-43-2 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 231.31 Pln | |
| Ambeed | 1g | 337.00 Pln | |
| Ambeed | 5g | 943.31 Pln | |
| Ambeed | 25g | 2422.94 Pln | |
| Chemat | 200mg | 150.80 Pln | |
| Chemat | 250mg | 170.00 Pln | |
| Chemat | 1g | 381.20 Pln | |
| Chemat | 5g | 875.60 Pln | |
| Chemat | 10g | 1442.00 Pln | |
| Chemat | 25g | 2157.20 Pln | |
| BLDpharm | 100mg | 197.73 Pln | |
| BLDpharm | 250mg | 247.72 Pln | |
| BLDpharm | 1g | 353.23 Pln | |
| BLDpharm | 5g | 1014.11 Pln | |
| BLDpharm | 25g | 2608.00 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Tert-butyl 3,5-dimethylpiperazine-1-carboxylate (CAS 639068-43-2) is a chemical compound with the molecular formula C11H22N2O2 and a molecular weight of 214.30 g/mol. IUPAC name: tert-butyl 3,5-dimethylpiperazine-1-carboxylate. InChIKey: NUZXPHIQZUYMOR-UHFFFAOYSA-N.
| Molecular formula | C11H22N2O2 |
|---|---|
| Molecular weight | 214.30 g/mol |
| IUPAC name | tert-butyl 3,5-dimethylpiperazine-1-carboxylate |
| InChIKey | NUZXPHIQZUYMOR-UHFFFAOYSA-N |
| SMILES | CC1CN(CC(N1)C)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)
Synonyms:
tert-butyl 3,5-dimethylpiperazine-1-carboxylate, 1-Boc-3,5-dimethylpiperazine, 3,5-Dimethyl-piperazine-1-carboxylic acid tert-butyl ester, trans-1-Boc-3,5-dimethyl-piperazine, Methisosildenafil Impurity 4, (3S,5S)-1-Boc-3,5-dimethyl-piperazine, Methisosildenafil-002, Methisosildenafil impure4, Methisosildenafil Impurity, Methisosildenafil Impurity
