cas: 518990-24-4 — see every product listed under this CAS number, including other names
tert-Butyl 3-(2-ethoxy-2-oxoacetyl)-4-oxopiperidine-1-carboxylate 95% (CAS 518990-24-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A540590-1g |
| cas | 518990-24-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 620.69 Pln | |
| Ambeed | 5g | 1722.06 Pln | |
| Ambeed | 10g | 2762.25 Pln | |
| Ambeed | 25g | 5448.94 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A540590 |
Tert-butyl 3-(2-ethoxy-2-oxoacetyl)-4-oxopiperidine-1-carboxylate (CAS 518990-24-4) is a chemical compound with the molecular formula C14H21NO6 and a molecular weight of 299.32 g/mol. IUPAC name: tert-butyl 3-(2-ethoxy-2-oxoacetyl)-4-oxopiperidine-1-carboxylate. InChIKey: RSNKXJXWNHBZEU-UHFFFAOYSA-N.
| Molecular formula | C14H21NO6 |
|---|---|
| Molecular weight | 299.32 g/mol |
| IUPAC name | tert-butyl 3-(2-ethoxy-2-oxoacetyl)-4-oxopiperidine-1-carboxylate |
| InChIKey | RSNKXJXWNHBZEU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)C1CN(CCC1=O)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)