cas: 1361386-63-1 — see every product listed under this CAS number, including other names
tert-Butyl 3-(3-amino-1H-pyrazol-1-yl)azetidine-1-carboxylate, 98% (CAS 1361386-63-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F624708-100MG |
| cas | 1361386-63-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 633.13 Pln | |
| Fluorochem | 250mg | 1028.82 Pln | |
| Fluorochem | 500mg | 1700.46 Pln | |
| Fluorochem | 1g | 2632.42 Pln | |
| Fluorochem | 5g | 11884.37 Pln | |
| Fluorochem | 10g | 19756.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 3-(3-aminopyrazol-1-yl)azetidine-1-carboxylate (CAS 1361386-63-1) is a chemical compound with the molecular formula C11H18N4O2 and a molecular weight of 238.29 g/mol. IUPAC name: tert-butyl 3-(3-aminopyrazol-1-yl)azetidine-1-carboxylate. InChIKey: PKYVWZDLZSTWHV-UHFFFAOYSA-N.
| Molecular formula | C11H18N4O2 |
|---|---|
| Molecular weight | 238.29 g/mol |
| IUPAC name | tert-butyl 3-(3-aminopyrazol-1-yl)azetidine-1-carboxylate |
| InChIKey | PKYVWZDLZSTWHV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)N2C=CC(=N2)N |
Computed by PubChem (NCBI)