cas: 942070-45-3 — see every product listed under this CAS number, including other names
tert-Butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-1-carboxylate 95% (CAS 942070-45-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A240211-250mg |
| cas | 942070-45-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 142.31 Pln | |
| Ambeed | 1g | 159.00 Pln | |
| Ambeed | 5g | 292.50 Pln | |
| Ambeed | 10g | 387.06 Pln | |
| Ambeed | 25g | 865.44 Pln | |
| Ambeed | 100g | 3246.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A240211 |
Tert-butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate (CAS 942070-45-3) is a chemical compound with the molecular formula C19H26BNO4 and a molecular weight of 343.2 g/mol. IUPAC name: tert-butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate. InChIKey: WWMZOMHUEMTTQO-UHFFFAOYSA-N.
| Molecular formula | C19H26BNO4 |
|---|---|
| Molecular weight | 343.2 g/mol |
| IUPAC name | tert-butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate |
| InChIKey | WWMZOMHUEMTTQO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(C3=CC=CC=C23)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)