cas: 935278-73-2 — see every product listed under this CAS number, including other names
tert-Butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrole-1-carboxylate, 97% (CAS 935278-73-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F222600-250MG |
| cas | 935278-73-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 315.53 Pln | |
| Fluorochem | 1g | 659.16 Pln | |
| Fluorochem | 5g | 1903.51 Pln | |
| Fluorochem | 25g | 9275.92 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrole-1-carboxylate (CAS 935278-73-2) is a chemical compound with the molecular formula C15H24BNO4 and a molecular weight of 293.17 g/mol. IUPAC name: tert-butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrole-1-carboxylate. InChIKey: STSRFVDSYZQVNM-UHFFFAOYSA-N.
| Molecular formula | C15H24BNO4 |
|---|---|
| Molecular weight | 293.17 g/mol |
| IUPAC name | tert-butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrole-1-carboxylate |
| InChIKey | STSRFVDSYZQVNM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(C=C2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)