cas: 1008526-71-3 — see every product listed under this CAS number, including other names
tert-Butyl 3-(aminomethyl)-3-hydroxyazetidine-1-carboxylate, 95%, 95% (CAS 1008526-71-3) is a chemical reagent available from Chemat. Available pack sizes: 100g, 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111419-100g |
| cas | 1008526-71-3 |
| size | 100g |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100g | 4240.40 Pln | |
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 136.40 Pln | |
| Chemat | 5g | 362.00 Pln | |
| Chemat | 10g | 587.60 Pln | |
| Chemat | 25g | 1187.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 3-(aminomethyl)-3-hydroxyazetidine-1-carboxylate (CAS 1008526-71-3) is a chemical compound with the molecular formula C9H18N2O3 and a molecular weight of 202.25 g/mol. IUPAC name: tert-butyl 3-(aminomethyl)-3-hydroxyazetidine-1-carboxylate. InChIKey: NVEHYSKQUSAZBP-UHFFFAOYSA-N.
| Molecular formula | C9H18N2O3 |
|---|---|
| Molecular weight | 202.25 g/mol |
| IUPAC name | tert-butyl 3-(aminomethyl)-3-hydroxyazetidine-1-carboxylate |
| InChIKey | NVEHYSKQUSAZBP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)(CN)O |
Computed by PubChem (NCBI)