cas: 189442-78-2 — see every product listed under this CAS number, including other names
tert-Butyl 3-(methoxy(methyl)carbamoyl)piperidine-1-carboxylate, 97% (CAS 189442-78-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F235422-1G |
| cas | 189442-78-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 122.89 Pln | |
| Fluorochem | 5g | 310.33 Pln | |
| Fluorochem | 10g | 372.80 Pln | |
| Fluorochem | 25g | 846.59 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Tert-butyl 3-[methoxy(methyl)carbamoyl]piperidine-1-carboxylate (CAS 189442-78-2) is a chemical compound with the molecular formula C13H24N2O4 and a molecular weight of 272.34 g/mol. IUPAC name: tert-butyl 3-[methoxy(methyl)carbamoyl]piperidine-1-carboxylate. InChIKey: NQGXVXHYGRAABB-UHFFFAOYSA-N.
| Molecular formula | C13H24N2O4 |
|---|---|
| Molecular weight | 272.34 g/mol |
| IUPAC name | tert-butyl 3-[methoxy(methyl)carbamoyl]piperidine-1-carboxylate |
| InChIKey | NQGXVXHYGRAABB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC(C1)C(=O)N(C)OC |
Computed by PubChem (NCBI)