cas: 863504-84-1 — see every product listed under this CAS number, including other names
tert-Butyl 3-amino-1H-pyrazole-1-carboxylate 97% (CAS 863504-84-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A477362-100mg |
| cas | 863504-84-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 120.06 Pln | |
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 153.44 Pln | |
| Ambeed | 5g | 437.12 Pln | |
| Ambeed | 25g | 1772.12 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A477362 |
Tert-butyl 3-aminopyrazole-1-carboxylate (CAS 863504-84-1) is a chemical compound with the molecular formula C8H13N3O2 and a molecular weight of 183.21 g/mol. IUPAC name: tert-butyl 3-aminopyrazole-1-carboxylate. InChIKey: SLWKHFGJHAEQPD-UHFFFAOYSA-N.
| Molecular formula | C8H13N3O2 |
|---|---|
| Molecular weight | 183.21 g/mol |
| IUPAC name | tert-butyl 3-aminopyrazole-1-carboxylate |
| InChIKey | SLWKHFGJHAEQPD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=CC(=N1)N |
Computed by PubChem (NCBI)