cas: 863504-84-1 — see every product listed under this CAS number, including other names
tert-Butyl 3-amino-1H-pyrazole-1-carboxylate, 95% (CAS 863504-84-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F094387-250MG |
| cas | 863504-84-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 102.07 Pln | |
| Fluorochem | 1g | 138.51 Pln | |
| Fluorochem | 5g | 409.25 Pln | |
| Fluorochem | 25g | 1684.84 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
Tert-butyl 3-aminopyrazole-1-carboxylate (CAS 863504-84-1) is a chemical compound with the molecular formula C8H13N3O2 and a molecular weight of 183.21 g/mol. IUPAC name: tert-butyl 3-aminopyrazole-1-carboxylate. InChIKey: SLWKHFGJHAEQPD-UHFFFAOYSA-N.
| Molecular formula | C8H13N3O2 |
|---|---|
| Molecular weight | 183.21 g/mol |
| IUPAC name | tert-butyl 3-aminopyrazole-1-carboxylate |
| InChIKey | SLWKHFGJHAEQPD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=CC(=N1)N |
Computed by PubChem (NCBI)