tert-Butyl 3-amino-3-(trifluoromethyl)azetidine-1-carboxylate, 95%
cas: 1258652-24-2 — see every product listed under this CAS number, including other names
tert-Butyl 3-amino-3-(trifluoromethyl)azetidine-1-carboxylate, 95% (CAS 1258652-24-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 500mg, 5g, 10g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A325152-100mg |
| cas | 1258652-24-2 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 737.50 Pln | |
| Ambeed | 250mg | 1138.00 Pln | |
| Ambeed | 1g | 2734.44 Pln | |
| Chemat | 100mg | 736.40 Pln | |
| Chemat | 250mg | 1139.60 Pln | |
| Chemat | 500mg | 2186.00 Pln | |
| Chemat | 1g | 2747.60 Pln | |
| Chemat | 5g | 9616.40 Pln | |
| Chemat | 10g | 15981.20 Pln | |
| BLDpharm | 100mg | 786.41 Pln | |
| BLDpharm | 250mg | 1225.15 Pln | |
| BLDpharm | 1g | 2946.76 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
Tert-butyl 3-amino-3-(trifluoromethyl)azetidine-1-carboxylate (CAS 1258652-24-2) is a chemical compound with the molecular formula C9H15F3N2O2 and a molecular weight of 240.22 g/mol. IUPAC name: tert-butyl 3-amino-3-(trifluoromethyl)azetidine-1-carboxylate. InChIKey: ORAKIPUXJZWAKD-UHFFFAOYSA-N.
| Molecular formula | C9H15F3N2O2 |
|---|---|
| Molecular weight | 240.22 g/mol |
| IUPAC name | tert-butyl 3-amino-3-(trifluoromethyl)azetidine-1-carboxylate |
| InChIKey | ORAKIPUXJZWAKD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)(C(F)(F)F)N |
Computed by PubChem (NCBI)
