cas: 871115-54-7 — see every product listed under this CAS number, including other names
tert-Butyl 3-amino-3-cyanopyrrolidine-1-carboxylate, 97% (CAS 871115-54-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F238625-100MG |
| cas | 871115-54-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 502.97 Pln | |
| Fluorochem | 250mg | 633.13 Pln | |
| Fluorochem | 500mg | 1065.27 Pln | |
| Fluorochem | 1g | 1408.90 Pln | |
| Fluorochem | 5g | 5225.26 Pln | |
| Fluorochem | 10g | 10249.53 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 3-amino-3-cyanopyrrolidine-1-carboxylate (CAS 871115-54-7) is a chemical compound with the molecular formula C10H17N3O2 and a molecular weight of 211.26 g/mol. IUPAC name: tert-butyl 3-amino-3-cyanopyrrolidine-1-carboxylate. InChIKey: NFLVTBMZGLRSPT-UHFFFAOYSA-N.
| Molecular formula | C10H17N3O2 |
|---|---|
| Molecular weight | 211.26 g/mol |
| IUPAC name | tert-butyl 3-amino-3-cyanopyrrolidine-1-carboxylate |
| InChIKey | NFLVTBMZGLRSPT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(C1)(C#N)N |
Computed by PubChem (NCBI)