cas: 355819-02-2 — see every product listed under this CAS number, including other names
tert-Butyl 3-amino-7,8-dihydro-1,6-naphthyridine-6(5H)-carboxylate 96% (CAS 355819-02-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A374713-100mg |
| cas | 355819-02-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 131.19 Pln | |
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 387.06 Pln | |
| Ambeed | 5g | 1627.50 Pln | |
| Ambeed | 25g | 5359.94 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A374713 |
Tert-butyl 3-amino-7,8-dihydro-5H-1,6-naphthyridine-6-carboxylate (CAS 355819-02-2) is a chemical compound with the molecular formula C13H19N3O2 and a molecular weight of 249.31 g/mol. IUPAC name: tert-butyl 3-amino-7,8-dihydro-5H-1,6-naphthyridine-6-carboxylate. InChIKey: YHALGDJDGQKVHY-UHFFFAOYSA-N.
| Molecular formula | C13H19N3O2 |
|---|---|
| Molecular weight | 249.31 g/mol |
| IUPAC name | tert-butyl 3-amino-7,8-dihydro-5H-1,6-naphthyridine-6-carboxylate |
| InChIKey | YHALGDJDGQKVHY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C(C1)C=C(C=N2)N |
Computed by PubChem (NCBI)