cas: 102638-45-9 — see every product listed under this CAS number, including other names
tert-Butyl 3-aminomethylbenzoate, 85% (CAS 102638-45-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F047425-250MG |
| cas | 102638-45-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 164.54 Pln | |
| Fluorochem | 1g | 471.73 Pln | |
| Fluorochem | 5g | 2106.57 Pln |
| purity | 85% |
|---|---|
| delivery time | 1-2 weeks |
Tert-butyl 3-(aminomethyl)benzoate (CAS 102638-45-9) is a chemical compound with the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. IUPAC name: tert-butyl 3-(aminomethyl)benzoate. InChIKey: HALKLPHYNWBHPB-UHFFFAOYSA-N.
| Molecular formula | C12H17NO2 |
|---|---|
| Molecular weight | 207.27 g/mol |
| IUPAC name | tert-butyl 3-(aminomethyl)benzoate |
| InChIKey | HALKLPHYNWBHPB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC=CC(=C1)CN |
Computed by PubChem (NCBI)