cas: 1080573-26-7 — see every product listed under this CAS number, including other names
tert-Butyl 3-bromo-4-chlorophenylcarbamate (CAS 1080573-26-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F629994-1G |
| cas | 1080573-26-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1611.95 Pln | |
| Fluorochem | 5g | 4683.79 Pln |
| delivery time | 3-4 weeks |
|---|
Tert-butyl N-(3-bromo-4-chlorophenyl)carbamate (CAS 1080573-26-7) is a chemical compound with the molecular formula C11H13BrClNO2 and a molecular weight of 306.58 g/mol. IUPAC name: tert-butyl N-(3-bromo-4-chlorophenyl)carbamate. InChIKey: CFQOESHBRDOJIP-UHFFFAOYSA-N.
| Molecular formula | C11H13BrClNO2 |
|---|---|
| Molecular weight | 306.58 g/mol |
| IUPAC name | tert-butyl N-(3-bromo-4-chlorophenyl)carbamate |
| InChIKey | CFQOESHBRDOJIP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC(=C(C=C1)Cl)Br |
Computed by PubChem (NCBI)