cas: 1430753-76-6 — see every product listed under this CAS number, including other names
tert-Butyl 3-bromo-6-fluoropicolinate, 97%, 97% (CAS 1430753-76-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HWSK-100mg |
| cas | 1430753-76-6 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 366.80 Pln | |
| Chemat | 250mg | 515.60 Pln | |
| Chemat | 1g | 654.80 Pln | |
| Chemat | 5g | 2867.60 Pln | |
| Chemat | 10g | 4797.20 Pln | |
| Chemat | 25g | 9515.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 3-bromo-6-fluoropyridine-2-carboxylate (CAS 1430753-76-6) is a chemical compound with the molecular formula C10H11BrFNO2 and a molecular weight of 276.10 g/mol. IUPAC name: tert-butyl 3-bromo-6-fluoropyridine-2-carboxylate. InChIKey: XXVBLAQLDHKBSP-UHFFFAOYSA-N.
| Molecular formula | C10H11BrFNO2 |
|---|---|
| Molecular weight | 276.10 g/mol |
| IUPAC name | tert-butyl 3-bromo-6-fluoropyridine-2-carboxylate |
| InChIKey | XXVBLAQLDHKBSP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=C(C=CC(=N1)F)Br |
Computed by PubChem (NCBI)