cas: 1184950-48-8 — see every product listed under this CAS number, including other names
tert-Butyl 3-bromo-7,8-dihydro-1,6-naphthyridine-6(5H)-carboxylate, 98%, 98% (CAS 1184950-48-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1187AO-100mg |
| cas | 1184950-48-8 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 390.80 Pln | |
| Chemat | 250mg | 621.20 Pln | |
| Chemat | 1g | 1571.60 Pln | |
| Chemat | 5g | 4595.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 3-bromo-7,8-dihydro-5H-1,6-naphthyridine-6-carboxylate (CAS 1184950-48-8) is a chemical compound with the molecular formula C13H17BrN2O2 and a molecular weight of 313.19 g/mol. IUPAC name: tert-butyl 3-bromo-7,8-dihydro-5H-1,6-naphthyridine-6-carboxylate. InChIKey: BWCWLVFPHPFTEW-UHFFFAOYSA-N.
| Molecular formula | C13H17BrN2O2 |
|---|---|
| Molecular weight | 313.19 g/mol |
| IUPAC name | tert-butyl 3-bromo-7,8-dihydro-5H-1,6-naphthyridine-6-carboxylate |
| InChIKey | BWCWLVFPHPFTEW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C(C1)C=C(C=N2)Br |
Computed by PubChem (NCBI)