cas: 1184950-48-8 — see every product listed under this CAS number, including other names
tert-Butyl 3-bromo-7,8-dihydro-1,6-naphthyridine-6(5H)-carboxylate, 97% (CAS 1184950-48-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F220340-100MG |
| cas | 1184950-48-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 565.44 Pln | |
| Fluorochem | 250mg | 883.04 Pln | |
| Fluorochem | 1g | 2257.56 Pln | |
| Fluorochem | 5g | 6906.96 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 3-bromo-7,8-dihydro-5H-1,6-naphthyridine-6-carboxylate (CAS 1184950-48-8) is a chemical compound with the molecular formula C13H17BrN2O2 and a molecular weight of 313.19 g/mol. IUPAC name: tert-butyl 3-bromo-7,8-dihydro-5H-1,6-naphthyridine-6-carboxylate. InChIKey: BWCWLVFPHPFTEW-UHFFFAOYSA-N.
| Molecular formula | C13H17BrN2O2 |
|---|---|
| Molecular weight | 313.19 g/mol |
| IUPAC name | tert-butyl 3-bromo-7,8-dihydro-5H-1,6-naphthyridine-6-carboxylate |
| InChIKey | BWCWLVFPHPFTEW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C(C1)C=C(C=N2)Br |
Computed by PubChem (NCBI)