cas: 518047-40-0 — see every product listed under this CAS number, including other names
tert-Butyl 3-cyanomorpholine-4-carboxylate 95% (CAS 518047-40-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A791351-250mg |
| cas | 518047-40-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 236.88 Pln | |
| Ambeed | 1g | 737.50 Pln | |
| Ambeed | 5g | 3374.12 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A791351 |
Tert-butyl 3-cyanomorpholine-4-carboxylate (CAS 518047-40-0) is a chemical compound with the molecular formula C10H16N2O3 and a molecular weight of 212.25 g/mol. IUPAC name: tert-butyl 3-cyanomorpholine-4-carboxylate. InChIKey: QSBSEJKNKHZYKD-UHFFFAOYSA-N.
| Molecular formula | C10H16N2O3 |
|---|---|
| Molecular weight | 212.25 g/mol |
| IUPAC name | tert-butyl 3-cyanomorpholine-4-carboxylate |
| InChIKey | QSBSEJKNKHZYKD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCOCC1C#N |
Computed by PubChem (NCBI)