cas: 1251021-18-7 — see every product listed under this CAS number, including other names
tert-Butyl 3-oxo-2,9-diazaspiro(5.5)undecane-9-carboxylate, 98+% (CAS 1251021-18-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A209086-1g |
| cas | 1251021-18-7 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 13187.65 Pln | |
| AmBeed | 5g | 39507.58 Pln | |
| AmBeed | 10g | 65742.88 Pln |
| purity | 98+% |
|---|---|
| delivery time | To be confirmed by Chemat |
Tert-butyl 3-oxo-2,9-diazaspiro[5.5]undecane-9-carboxylate (CAS 1251021-18-7) is a chemical compound with the molecular formula C14H24N2O3 and a molecular weight of 268.35 g/mol. IUPAC name: tert-butyl 3-oxo-2,9-diazaspiro[5.5]undecane-9-carboxylate. InChIKey: RVORUJPDSDOBTI-UHFFFAOYSA-N.
| Molecular formula | C14H24N2O3 |
|---|---|
| Molecular weight | 268.35 g/mol |
| IUPAC name | tert-butyl 3-oxo-2,9-diazaspiro[5.5]undecane-9-carboxylate |
| InChIKey | RVORUJPDSDOBTI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CCC(=O)NC2)CC1 |
Computed by PubChem (NCBI)