cas: 1226776-87-9 — see every product listed under this CAS number, including other names
tert-Butyl 3-phenyl-5,6-dihydroimidazo[1,2-a]pyrazine-7(8H)-carboxylate (CAS 1226776-87-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F447054-100MG |
| cas | 1226776-87-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 841.39 Pln | |
| Fluorochem | 250mg | 1226.67 Pln | |
| Fluorochem | 1g | 2950.02 Pln | |
| Fluorochem | 5g | 14180.44 Pln |
| delivery time | 3-4 weeks |
|---|
Tert-butyl 3-phenyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-7-carboxylate (CAS 1226776-87-9) is a chemical compound with the molecular formula C17H21N3O2 and a molecular weight of 299.37 g/mol. IUPAC name: tert-butyl 3-phenyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-7-carboxylate. InChIKey: NCLANSDSIRSLJV-UHFFFAOYSA-N.
| Molecular formula | C17H21N3O2 |
|---|---|
| Molecular weight | 299.37 g/mol |
| IUPAC name | tert-butyl 3-phenyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-7-carboxylate |
| InChIKey | NCLANSDSIRSLJV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN2C(=NC=C2C3=CC=CC=C3)C1 |
Computed by PubChem (NCBI)