cas: 147410-43-3 — see every product listed under this CAS number, including other names
tert-Butyl 3-phenylpyrrolidine-1-carboxylate, 95% (CAS 147410-43-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F234946-100MG |
| cas | 147410-43-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 877.83 Pln | |
| Fluorochem | 250mg | 1788.97 Pln | |
| Fluorochem | 1g | 3043.74 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 3-phenylpyrrolidine-1-carboxylate (CAS 147410-43-3) is a chemical compound with the molecular formula C15H21NO2 and a molecular weight of 247.33 g/mol. IUPAC name: tert-butyl 3-phenylpyrrolidine-1-carboxylate. InChIKey: REGWJCQNMMXFBM-UHFFFAOYSA-N.
| Molecular formula | C15H21NO2 |
|---|---|
| Molecular weight | 247.33 g/mol |
| IUPAC name | tert-butyl 3-phenylpyrrolidine-1-carboxylate |
| InChIKey | REGWJCQNMMXFBM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)