cas: 1186688-52-7 — see every product listed under this CAS number, including other names
tert-Butyl 4,4-difluoro-3-hydroxypiperidine-1-carboxylate 95% (CAS 1186688-52-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A760400-100mg |
| cas | 1186688-52-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 943.31 Pln | |
| Ambeed | 250mg | 1499.56 Pln | |
| Ambeed | 1g | 3952.62 Pln | |
| Ambeed | 5g | 12635.69 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A760400 |
Tert-butyl 4,4-difluoro-3-hydroxypiperidine-1-carboxylate (CAS 1186688-52-7) is a chemical compound with the molecular formula C10H17F2NO3 and a molecular weight of 237.24 g/mol. IUPAC name: tert-butyl 4,4-difluoro-3-hydroxypiperidine-1-carboxylate. InChIKey: WMSNGRGUQYKMEF-UHFFFAOYSA-N.
| Molecular formula | C10H17F2NO3 |
|---|---|
| Molecular weight | 237.24 g/mol |
| IUPAC name | tert-butyl 4,4-difluoro-3-hydroxypiperidine-1-carboxylate |
| InChIKey | WMSNGRGUQYKMEF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(C1)O)(F)F |
Computed by PubChem (NCBI)