cas: 710977-70-1 — see every product listed under this CAS number, including other names
tert-Butyl 4-((tetrahydro-2H-pyran-4-yl)amino)piperidine-1-carboxylate 97% (CAS 710977-70-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A996464-100mg |
| cas | 710977-70-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 731.94 Pln | |
| Ambeed | 250mg | 871.00 Pln | |
| Ambeed | 1g | 2072.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A996464 |
Tert-butyl 4-(oxan-4-ylamino)piperidine-1-carboxylate (CAS 710977-70-1) is a chemical compound with the molecular formula C15H28N2O3 and a molecular weight of 284.39 g/mol. IUPAC name: tert-butyl 4-(oxan-4-ylamino)piperidine-1-carboxylate. InChIKey: OBEVPDNEUFHSBB-UHFFFAOYSA-N.
| Molecular formula | C15H28N2O3 |
|---|---|
| Molecular weight | 284.39 g/mol |
| IUPAC name | tert-butyl 4-(oxan-4-ylamino)piperidine-1-carboxylate |
| InChIKey | OBEVPDNEUFHSBB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)NC2CCOCC2 |
Computed by PubChem (NCBI)