Products 1267481-31-1

CAS 1267481-31-1 is the registry number for 4-(2-Hydroxy-cyclohexyl)-piperazine-1-carboxylic acid tert-butyl ester, 90%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

Tert-butyl 4-(2-hydroxycyclohexyl)piperazine-1-carboxylate (CAS 1267481-31-1) is a chemical compound with the molecular formula C15H28N2O3 and a molecular weight of 284.39 g/mol. IUPAC name: tert-butyl 4-(2-hydroxycyclohexyl)piperazine-1-carboxylate. InChIKey: HPEUFZJDMPYRGN-UHFFFAOYSA-N.

Identity
Molecular formulaC15H28N2O3
Molecular weight284.39 g/mol
IUPAC nametert-butyl 4-(2-hydroxycyclohexyl)piperazine-1-carboxylate
InChIKeyHPEUFZJDMPYRGN-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCN(CC1)C2CCCCC2O

Computed by PubChem (NCBI)