cas: 135716-09-5 — see every product listed under this CAS number, including other names
tert-Butyl 4-(2-ethoxy-2-oxoethyl)piperidine-1-carboxylate, 95% (CAS 135716-09-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 25g, 100g, 250g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F212562-1G |
| cas | 135716-09-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 96.86 Pln | |
| Fluorochem | 25g | 195.78 Pln | |
| Fluorochem | 100g | 565.44 Pln | |
| Fluorochem | 250g | 1330.80 Pln | |
| Fluorochem | 500g | 2090.95 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
Tert-butyl 4-(2-ethoxy-2-oxoethyl)piperidine-1-carboxylate (CAS 135716-09-5) is a chemical compound with the molecular formula C14H25NO4 and a molecular weight of 271.35 g/mol. IUPAC name: tert-butyl 4-(2-ethoxy-2-oxoethyl)piperidine-1-carboxylate. InChIKey: PQEXLIRUMIRSAL-UHFFFAOYSA-N.
| Molecular formula | C14H25NO4 |
|---|---|
| Molecular weight | 271.35 g/mol |
| IUPAC name | tert-butyl 4-(2-ethoxy-2-oxoethyl)piperidine-1-carboxylate |
| InChIKey | PQEXLIRUMIRSAL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1CCN(CC1)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)