tert-Butyl 4-(3,3,3-trifluoro-2-hydroxypropyl)piperidine-1-carboxylate, 95%
cas: 1228631-10-4 — see every product listed under this CAS number, including other names
tert-Butyl 4-(3,3,3-trifluoro-2-hydroxypropyl)piperidine-1-carboxylate, 95% (CAS 1228631-10-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg, 500mg. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A662482-250mg |
| cas | 1228631-10-4 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 259.12 Pln | |
| Ambeed | 1g | 548.38 Pln | |
| Ambeed | 5g | 2239.38 Pln | |
| Chemat | 100mg | 155.60 Pln | |
| Chemat | 250mg | 232.40 Pln | |
| Chemat | 500mg | 400.40 Pln | |
| Chemat | 1g | 486.80 Pln | |
| BLDpharm | 100mg | 186.63 Pln | |
| BLDpharm | 250mg | 275.48 Pln | |
| BLDpharm | 1g | 580.93 Pln | |
| BLDpharm | 5g | 2391.40 Pln | |
| Fluorochem | 100mg | 258.26 Pln | |
| Fluorochem | 250mg | 404.04 Pln | |
| Fluorochem | 1g | 888.25 Pln | |
| Fluorochem | 500mg | 726.85 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
Tert-butyl 4-(3,3,3-trifluoro-2-hydroxypropyl)piperidine-1-carboxylate (CAS 1228631-10-4) is a chemical compound with the molecular formula C13H22F3NO3 and a molecular weight of 297.31 g/mol. IUPAC name: tert-butyl 4-(3,3,3-trifluoro-2-hydroxypropyl)piperidine-1-carboxylate. InChIKey: YLPPNASJYIAVQZ-UHFFFAOYSA-N.
| Molecular formula | C13H22F3NO3 |
|---|---|
| Molecular weight | 297.31 g/mol |
| IUPAC name | tert-butyl 4-(3,3,3-trifluoro-2-hydroxypropyl)piperidine-1-carboxylate |
| InChIKey | YLPPNASJYIAVQZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)CC(C(F)(F)F)O |
Computed by PubChem (NCBI)